C42H48N4O2 — CID 10770426
2-(3,7,13,17-tetraethyl-2,8,12,18-tetramethyl-15-phenyl-23,24-dihydroporphyrin-5-yl)ethyl acetate (PubChem CID 10770426) has the molecular formula C42H48N4O2 and a molecular weight of 640.87 g/mol. Its IUPAC name is 2-(3,7,13,17-tetraethyl-2,8,12,18-tetramethyl-15-phenyl-23,24-dihydroporphyrin-5-yl)ethyl acetate.
| Compound Name | 2-(3,7,13,17-tetraethyl-2,8,12,18-tetramethyl-15-phenyl-23,24-dihydroporphyrin-5-yl)ethyl acetate |
|---|---|
| PubChem CID | 10770426 |
| Molecular Formula | C42H48N4O2 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | 2-(3,7,13,17-tetraethyl-2,8,12,18-tetramethyl-15-phenyl-23,24-dihydroporphyrin-5-yl)ethyl acetate |
| SMILES | CCC1=C(C)c2cc3[nH]c(c(CC)c3C)c(-c3ccccc3)c3[nH]c(cc4nc(c(CCOC(C)=O)c1n2)C(CC)=C4C)c(C)c3CC |
| InChI | InChI=1S/C42H48N4O2/c1-10-29-23(5)34-21-36-25(7)31(12-3)41(45-36)38(28-17-15-14-16-18-28)42-32(13-4)26(8)37(46-42)22-35-24(6)30(11-2)40(44-35)33(39(29)43-34)19-20-48-27(9)47/h14-18,21-22,45-46H,10-13,19-20H2,1-9H3/b34-21-,35-22-,36-21-,37-22-,39-33-,40-33-,41-38-,42-38- |
| InChIKey | PXJYJSHYZZPLQA-CSBOLBGYSA-N |
| XLogP | 10.51 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |