C53H52N4O3 — CID 11479832
benzyl 4-[13-ethenyl-3,7,17-triethyl-15-(4-methoxyphenyl)-2,8,12,18-tetramethyl-23,24-dihydroporphyrin-5-yl]benzoate (PubChem CID 11479832) has the molecular formula C53H52N4O3 and a molecular weight of 793.02 g/mol. Its IUPAC name is benzyl 4-[13-ethenyl-3,7,17-triethyl-15-(4-methoxyphenyl)-2,8,12,18-tetramethyl-23,24-dihydroporphyrin-5-yl]benzoate.
| Compound Name | benzyl 4-[13-ethenyl-3,7,17-triethyl-15-(4-methoxyphenyl)-2,8,12,18-tetramethyl-23,24-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 11479832 |
| Molecular Formula | C53H52N4O3 |
| Molecular Weight | 793.02 g/mol |
| Exact Mass | 792.40 |
| IUPAC Name | benzyl 4-[13-ethenyl-3,7,17-triethyl-15-(4-methoxyphenyl)-2,8,12,18-tetramethyl-23,24-dihydroporphyrin-5-yl]benzoate |
| SMILES | C=Cc1c(C)c2cc3nc(c(-c4ccc(C(=O)OCc5ccccc5)cc4)c4nc(cc5[nH]c(c(CC)c5C)c(-c5ccc(OC)cc5)c1[nH]2)C(C)=C4CC)C(CC)=C3C |
| InChI | InChI=1S/C53H52N4O3/c1-10-39-30(5)43-27-45-32(7)41(12-3)51(56-45)48(36-23-25-38(59-9)26-24-36)52-42(13-4)33(8)46(57-52)28-44-31(6)40(11-2)50(55-44)47(49(39)54-43)35-19-21-37(22-20-35)53(58)60-29-34-17-15-14-16-18-34/h12,14-28,56-57H,3,10-11,13,29H2,1-2,4-9H3/b43-27-,44-28-,45-27-,46-28-,49-47-,50-47-,51-48-,52-48- |
| InChIKey | LAGJXUFKBWCFQX-FRGZQOCHSA-N |
| XLogP | 13.52 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.02 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |