C47H49ClN4O3 — CID 11331674
methyl 4-[13-(2-chloroethyl)-3,7,17-triethyl-15-(4-methoxyphenyl)-2,8,12,18-tetramethyl-21,22-dihydroporphyrin-5-yl]benzoate (PubChem CID 11331674) has the molecular formula C47H49ClN4O3 and a molecular weight of 753.39 g/mol. Its IUPAC name is methyl 4-[13-(2-chloroethyl)-3,7,17-triethyl-15-(4-methoxyphenyl)-2,8,12,18-tetramethyl-21,22-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[13-(2-chloroethyl)-3,7,17-triethyl-15-(4-methoxyphenyl)-2,8,12,18-tetramethyl-21,22-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 11331674 |
| Molecular Formula | C47H49ClN4O3 |
| Molecular Weight | 753.39 g/mol |
| Exact Mass | 752.35 |
| IUPAC Name | methyl 4-[13-(2-chloroethyl)-3,7,17-triethyl-15-(4-methoxyphenyl)-2,8,12,18-tetramethyl-21,22-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCC1=C(C)c2cc3[nH]c(c(CC)c3C)c(-c3ccc(C(=O)OC)cc3)c3[nH]c(cc4nc(c(-c5ccc(OC)cc5)c1n2)C(CCCl)=C4C)c(C)c3CC |
| InChI | InChI=1S/C47H49ClN4O3/c1-10-33-25(4)37-23-38-27(6)35(12-3)45(51-38)42(30-17-19-32(54-8)20-18-30)46-36(21-22-48)28(7)40(52-46)24-39-26(5)34(11-2)44(50-39)41(43(33)49-37)29-13-15-31(16-14-29)47(53)55-9/h13-20,23-24,49-50H,10-12,21-22H2,1-9H3/b37-23-,38-23-,39-24-,40-24-,43-41-,44-41-,45-42-,46-42- |
| InChIKey | CBHFWQDVXXMNGU-HLGYMJBZSA-N |
| XLogP | 12.09 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.39 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|