C49H58N4O6 — CID 173488074
methyl 4-[7,8,12,13-tetraethyl-18-(4-methoxy-4-oxobutyl)-10-[2-(2-methoxy-2-oxoethyl)phenyl]-3,17-dimethyl-21,23-dihydroporphyrin-2-yl]butanoate (PubChem CID 173488074) has the molecular formula C49H58N4O6 and a molecular weight of 799.02 g/mol. Its IUPAC name is methyl 4-[7,8,12,13-tetraethyl-18-(4-methoxy-4-oxobutyl)-10-[2-(2-methoxy-2-oxoethyl)phenyl]-3,17-dimethyl-21,23-dihydroporphyrin-2-yl]butanoate.
| Compound Name | methyl 4-[7,8,12,13-tetraethyl-18-(4-methoxy-4-oxobutyl)-10-[2-(2-methoxy-2-oxoethyl)phenyl]-3,17-dimethyl-21,23-dihydroporphyrin-2-yl]butanoate |
|---|---|
| PubChem CID | 173488074 |
| Molecular Formula | C49H58N4O6 |
| Molecular Weight | 799.02 g/mol |
| Exact Mass | 798.44 |
| IUPAC Name | methyl 4-[7,8,12,13-tetraethyl-18-(4-methoxy-4-oxobutyl)-10-[2-(2-methoxy-2-oxoethyl)phenyl]-3,17-dimethyl-21,23-dihydroporphyrin-2-yl]butanoate |
| SMILES | CCC1=C(CC)c2nc1cc1[nH]c(cc3nc(cc4[nH]c(c(CC)c4CC)c2-c2ccccc2CC(=O)OC)C(C)=C3CCCC(=O)OC)c(CCCC(=O)OC)c1C |
| InChI | InChI=1S/C49H58N4O6/c1-10-31-33(12-3)48-47(37-19-15-14-18-30(37)24-46(56)59-9)49-34(13-4)32(11-2)41(53-49)26-39-29(6)36(21-17-23-45(55)58-8)43(51-39)27-42-35(20-16-22-44(54)57-7)28(5)38(50-42)25-40(31)52-48/h14-15,18-19,25-27,50,53H,10-13,16-17,20-24H2,1-9H3/b38-25-,39-26-,40-25-,41-26-,42-27-,43-27-,48-47-,49-47- |
| InChIKey | JHZOUNOWLPEIDA-IEGVBSPXSA-N |
| XLogP | 10.63 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.02 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|