C48H62N4 — CID 10919738
2,3,7,8,12,13,17,18-octaethyl-15-hexyl-10-phenyl-21,22-dihydroporphyrin (PubChem CID 10919738) has the molecular formula C48H62N4 and a molecular weight of 695.05 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-15-hexyl-10-phenyl-21,22-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-15-hexyl-10-phenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10919738 |
| Molecular Formula | C48H62N4 |
| Molecular Weight | 695.05 g/mol |
| Exact Mass | 694.50 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-15-hexyl-10-phenyl-21,22-dihydroporphyrin |
| SMILES | CCCCCCc1c2nc(cc3[nH]c(cc4[nH]c(c(CC)c4CC)c(-c4ccccc4)c4nc1C(CC)=C4CC)c(CC)c3CC)C(CC)=C2CC |
| InChI | InChI=1S/C48H62N4/c1-10-19-20-24-27-39-45-35(15-6)33(13-4)42(50-45)28-40-31(11-2)32(12-3)41(49-40)29-43-34(14-5)36(16-7)47(51-43)44(30-25-22-21-23-26-30)48-38(18-9)37(17-8)46(39)52-48/h21-23,25-26,28-29,49,51H,10-20,24,27H2,1-9H3/b40-28-,41-29-,42-28-,43-29-,45-39-,46-39-,47-44-,48-44- |
| InChIKey | BLMGGKJGZUHSIY-SDLNMIOPSA-N |
| XLogP | 13.82 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.05 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|