C36H46MgN4+2 — CID 21120224
magnesium 2,3,12,13,15,17,18,20-octaethyl-21,22-dihydroporphyrin (PubChem CID 21120224) has the molecular formula C36H46MgN4+2 and a molecular weight of 559.10 g/mol. Its IUPAC name is magnesium 2,3,12,13,15,17,18,20-octaethyl-21,22-dihydroporphyrin.
| Compound Name | magnesium 2,3,12,13,15,17,18,20-octaethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 21120224 |
| Molecular Formula | C36H46MgN4+2 |
| Molecular Weight | 559.10 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | magnesium 2,3,12,13,15,17,18,20-octaethyl-21,22-dihydroporphyrin |
| SMILES | CCC1=C(CC)c2nc1cc1ccc(cc3[nH]c(c(CC)c4nc(c2CC)C(CC)=C4CC)c(CC)c3CC)[nH]1.[Mg+2] |
| InChI | InChI=1S/C36H46N4.Mg/c1-9-23-25(11-3)33-29(15-7)35-27(13-5)28(14-6)36(40-35)30(16-8)34-26(12-4)24(10-2)32(39-34)20-22-18-17-21(37-22)19-31(23)38-33;/h17-20,37-38H,9-16H2,1-8H3;/q;+2/b21-19-,22-20-,31-19-,32-20-,33-29-,34-30-,35-29-,36-30-; |
| InChIKey | CCUUSNLENFLDOI-JTJOWCOOSA-N |
| XLogP | 9.65 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.10 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |