C41H56N4 — CID 153425392
2,3,7,8,12,13,18-heptaethyl-17-heptyl-21,22-dihydroporphyrin (PubChem CID 153425392) has the molecular formula C41H56N4 and a molecular weight of 604.93 g/mol. Its IUPAC name is 2,3,7,8,12,13,18-heptaethyl-17-heptyl-21,22-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,18-heptaethyl-17-heptyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 153425392 |
| Molecular Formula | C41H56N4 |
| Molecular Weight | 604.93 g/mol |
| Exact Mass | 604.45 |
| IUPAC Name | 2,3,7,8,12,13,18-heptaethyl-17-heptyl-21,22-dihydroporphyrin |
| SMILES | CCCCCCCC1=C(CC)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(CC)=C5CC)c(CC)c4CC)c(CC)c3CC |
| InChI | InChI=1S/C41H56N4/c1-9-17-18-19-20-21-33-32(16-8)40-24-38-29(13-5)28(12-4)36(43-38)22-34-26(10-2)27(11-3)35(42-34)23-37-30(14-6)31(15-7)39(44-37)25-41(33)45-40/h22-25,42-43H,9-21H2,1-8H3/b34-22-,35-23-,36-22-,37-23-,38-24-,39-25-,40-24-,41-25- |
| InChIKey | MJXVLKSWXHTPSM-HRAMZSHQSA-N |
| XLogP | 11.98 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.93 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|