C54H66N4 — CID 10557419
2,3,7,8,12,13,17,18-octaethyl-10-hexyl-15,20-diphenyl-21,22-dihydroporphyrin (PubChem CID 10557419) has the molecular formula C54H66N4 and a molecular weight of 771.15 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-10-hexyl-15,20-diphenyl-21,22-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-10-hexyl-15,20-diphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10557419 |
| Molecular Formula | C54H66N4 |
| Molecular Weight | 771.15 g/mol |
| Exact Mass | 770.53 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-10-hexyl-15,20-diphenyl-21,22-dihydroporphyrin |
| SMILES | CCCCCCc1c2nc(c(-c3ccccc3)c3nc(c(-c4ccccc4)c4[nH]c(cc5[nH]c1c(CC)c5CC)c(CC)c4CC)C(CC)=C3CC)C(CC)=C2CC |
| InChI | InChI=1S/C54H66N4/c1-10-19-20-27-32-44-49-38(13-4)36(11-2)45(55-49)33-46-37(12-3)39(14-5)51(56-46)47(34-28-23-21-24-29-34)53-42(17-8)43(18-9)54(58-53)48(35-30-25-22-26-31-35)52-41(16-7)40(15-6)50(44)57-52/h21-26,28-31,33,55-56H,10-20,27,32H2,1-9H3/b45-33-,46-33-,49-44-,50-44-,51-47-,52-48-,53-47-,54-48- |
| InChIKey | OXDAXIGEBYSNER-GMVJQLCSSA-N |
| XLogP | 15.48 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.15 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|