C52H46N4O4 — CID 135533344
2,7,12,17-tetrakis(2-methoxyphenyl)-3,8,13,18-tetramethyl-21,23-dihydroporphyrin (PubChem CID 135533344) has the molecular formula C52H46N4O4 and a molecular weight of 790.96 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(2-methoxyphenyl)-3,8,13,18-tetramethyl-21,23-dihydroporphyrin.
| Compound Name | 2,7,12,17-tetrakis(2-methoxyphenyl)-3,8,13,18-tetramethyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135533344 |
| Molecular Formula | C52H46N4O4 |
| Molecular Weight | 790.96 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | 2,7,12,17-tetrakis(2-methoxyphenyl)-3,8,13,18-tetramethyl-21,23-dihydroporphyrin |
| SMILES | COc1ccccc1C1=C(C)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(C)c5-c1ccccc1OC)C(C)=C4c1ccccc1OC)c(C)c3-c1ccccc1OC |
| InChI | InChI=1S/C52H46N4O4/c1-29-37-25-42-50(34-18-10-14-22-46(34)58-6)31(3)39(54-42)27-44-52(36-20-12-16-24-48(36)60-8)32(4)40(56-44)28-43-51(35-19-11-15-23-47(35)59-7)30(2)38(55-43)26-41(53-37)49(29)33-17-9-13-21-45(33)57-5/h9-28,53,56H,1-8H3/b37-25-,38-26-,39-27-,40-28-,41-26-,42-25-,43-28-,44-27- |
| InChIKey | XYPQZRJGMCXVTO-LMWXFGCKSA-N |
| XLogP | 12.26 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.96 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |