C52H48N4O2 — CID 91412808
5,15-bis(2-methoxyphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91412808) has the molecular formula C52H48N4O2 and a molecular weight of 760.98 g/mol. Its IUPAC name is 5,15-bis(2-methoxyphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,15-bis(2-methoxyphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91412808 |
| Molecular Formula | C52H48N4O2 |
| Molecular Weight | 760.98 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | 5,15-bis(2-methoxyphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | COc1ccccc1C1=c2ccc([nH]2)=C(c2c(C)cc(C)cc2C)c2ccc([nH]2)C(c2ccccc2OC)=c2ccc([nH]2)=C(c2c(C)cc(C)cc2C)c2ccc1[nH]2 |
| InChI | InChI=1S/C52H48N4O2/c1-29-25-31(3)47(32(4)26-29)51-41-21-17-37(53-41)49(35-13-9-11-15-45(35)57-7)39-19-23-43(55-39)52(48-33(5)27-30(2)28-34(48)6)44-24-20-40(56-44)50(38-18-22-42(51)54-38)36-14-10-12-16-46(36)58-8/h9-28,53-56H,1-8H3 |
| InChIKey | HUFUAPJSZFCRJQ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.98 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |