C24H23OP — CID 164676483
2-(2-methoxyphenyl)-3-(2,4,6-trimethylphenyl)-1H-phosphindole (PubChem CID 164676483) has the molecular formula C24H23OP and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-3-(2,4,6-trimethylphenyl)-1H-phosphindole.
| Compound Name | 2-(2-methoxyphenyl)-3-(2,4,6-trimethylphenyl)-1H-phosphindole |
|---|---|
| PubChem CID | 164676483 |
| Molecular Formula | C24H23OP |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-(2-methoxyphenyl)-3-(2,4,6-trimethylphenyl)-1H-phosphindole |
| SMILES | COc1ccccc1-c1[pH]c2ccccc2c1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H23OP/c1-15-13-16(2)22(17(3)14-15)23-19-10-6-8-12-21(19)26-24(23)18-9-5-7-11-20(18)25-4/h5-14,26H,1-4H3 |
| InChIKey | GZBNBLQXIWUZIK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |