C16H16O2 — CID 106681100
2-(2-methoxy-4,6-dimethylphenyl)benzaldehyde (PubChem CID 106681100) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-(2-methoxy-4,6-dimethylphenyl)benzaldehyde.
| Compound Name | 2-(2-methoxy-4,6-dimethylphenyl)benzaldehyde |
|---|---|
| PubChem CID | 106681100 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-(2-methoxy-4,6-dimethylphenyl)benzaldehyde |
| SMILES | COc1cc(C)cc(C)c1-c1ccccc1C=O |
| InChI | InChI=1S/C16H16O2/c1-11-8-12(2)16(15(9-11)18-3)14-7-5-4-6-13(14)10-17/h4-10H,1-3H3 |
| InChIKey | DDAVOKPANHYHJS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|