C56H54N4 — CID 11072769
2,7,12,17-tetramethyl-3,8,13,18-tetrakis(2-phenylethyl)-21,22-dihydroporphyrin (PubChem CID 11072769) has the molecular formula C56H54N4 and a molecular weight of 783.08 g/mol. Its IUPAC name is 2,7,12,17-tetramethyl-3,8,13,18-tetrakis(2-phenylethyl)-21,22-dihydroporphyrin.
| Compound Name | 2,7,12,17-tetramethyl-3,8,13,18-tetrakis(2-phenylethyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11072769 |
| Molecular Formula | C56H54N4 |
| Molecular Weight | 783.08 g/mol |
| Exact Mass | 782.43 |
| IUPAC Name | 2,7,12,17-tetramethyl-3,8,13,18-tetrakis(2-phenylethyl)-21,22-dihydroporphyrin |
| SMILES | CC1=C(CCc2ccccc2)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(CCc1ccccc1)c5C)c(CCc1ccccc1)c4C)C(CCc1ccccc1)=C3C |
| InChI | InChI=1S/C56H54N4/c1-37-45(29-25-41-17-9-5-10-18-41)53-34-50-39(3)47(31-27-43-21-13-7-14-22-43)55(59-50)36-52-40(4)48(32-28-44-23-15-8-16-24-44)56(60-52)35-51-38(2)46(54(58-51)33-49(37)57-53)30-26-42-19-11-6-12-20-42/h5-24,33-36,57-58H,25-32H2,1-4H3/b49-33-,50-34-,51-35-,52-36-,53-34-,54-33-,55-36-,56-35- |
| InChIKey | GWSRNBGUPZMLLH-CMBFWLMTSA-N |
| XLogP | 13.63 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.08 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |