C70H63N4P — CID 136811231
2-[3-[15-(3,5-ditert-butylphenyl)-3,7,13,17-tetramethyl-2,8,12,18-tetraphenyl-21,23-dihydroporphyrin-5-yl]phenyl]ethynylphosphane (PubChem CID 136811231) has the molecular formula C70H63N4P and a molecular weight of 991.28 g/mol. Its IUPAC name is 2-[3-[15-(3,5-ditert-butylphenyl)-3,7,13,17-tetramethyl-2,8,12,18-tetraphenyl-21,23-dihydroporphyrin-5-yl]phenyl]ethynylphosphane.
| Compound Name | 2-[3-[15-(3,5-ditert-butylphenyl)-3,7,13,17-tetramethyl-2,8,12,18-tetraphenyl-21,23-dihydroporphyrin-5-yl]phenyl]ethynylphosphane |
|---|---|
| PubChem CID | 136811231 |
| Molecular Formula | C70H63N4P |
| Molecular Weight | 991.28 g/mol |
| Exact Mass | 990.48 |
| IUPAC Name | 2-[3-[15-(3,5-ditert-butylphenyl)-3,7,13,17-tetramethyl-2,8,12,18-tetraphenyl-21,23-dihydroporphyrin-5-yl]phenyl]ethynylphosphane |
| SMILES | CC1=C(c2ccccc2)c2cc3[nH]c(c(C)c3-c3ccccc3)c(-c3cccc(C#CP)c3)c3nc(cc4[nH]c(c(C)c4-c4ccccc4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c1n2)C(c1ccccc1)=C3C |
| InChI | InChI=1S/C70H63N4P/c1-42-59(47-25-15-11-16-26-47)55-40-57-61(49-29-19-13-20-30-49)44(3)67(73-57)64(52-37-53(69(5,6)7)39-54(38-52)70(8,9)10)68-45(4)62(50-31-21-14-22-32-50)58(74-68)41-56-60(48-27-17-12-18-28-48)43(2)66(72-56)63(65(42)71-55)51-33-23-24-46(36-51)34-35-75/h11-33,36-41,71,74H,75H2,1-10H3/b55-40-,56-41-,57-40-,58-41-,65-63-,66-63-,67-64-,68-64- |
| InChIKey | QSLOGKPNZLSYKZ-WNWYCHRQSA-N |
| XLogP | 18.34 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.28 |
| LogP ≤ 5 | 18.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|