C32H35N5O — CID 177045492
3-(15-methoxy-2,2,12,12-tetramethyl-3,13,22,24-tetrahydroporphyrin-5-yl)-N-methylaniline (PubChem CID 177045492) has the molecular formula C32H35N5O and a molecular weight of 505.67 g/mol. Its IUPAC name is 3-(15-methoxy-2,2,12,12-tetramethyl-3,13,22,24-tetrahydroporphyrin-5-yl)-N-methylaniline.
| Compound Name | 3-(15-methoxy-2,2,12,12-tetramethyl-3,13,22,24-tetrahydroporphyrin-5-yl)-N-methylaniline |
|---|---|
| PubChem CID | 177045492 |
| Molecular Formula | C32H35N5O |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | 3-(15-methoxy-2,2,12,12-tetramethyl-3,13,22,24-tetrahydroporphyrin-5-yl)-N-methylaniline |
| SMILES | CNc1cccc(-c2c3nc(cc4ccc([nH]4)c(OC)c4nc(cc5ccc2[nH]5)C(C)(C)C4)C(C)(C)C3)c1 |
| InChI | InChI=1S/C32H35N5O/c1-31(2)17-25-29(19-8-7-9-20(14-19)33-5)23-12-10-21(34-23)15-28-32(3,4)18-26(37-28)30(38-6)24-13-11-22(35-24)16-27(31)36-25/h7-16,33-35H,17-18H2,1-6H3/b21-15-,22-16-,27-16-,28-15-,29-23-,29-25-,30-24+,30-26+ |
| InChIKey | IRMJZECMZCFRSU-HJXLPYBMSA-N |
| XLogP | 7.07 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |