C41H44N4O2 — CID 90327574
10-(2-methoxyethoxy)-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin (PubChem CID 90327574) has the molecular formula C41H44N4O2 and a molecular weight of 624.83 g/mol. Its IUPAC name is 10-(2-methoxyethoxy)-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 10-(2-methoxyethoxy)-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90327574 |
| Molecular Formula | C41H44N4O2 |
| Molecular Weight | 624.83 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | 10-(2-methoxyethoxy)-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin |
| SMILES | COCCOc1c2nc(cc3[nH]c(cc4nc(cc5[nH]c1cc5-c1ccc(C)cc1)C(C)(C)C4)cc3-c1ccc(C)cc1)C(C)(C)C2 |
| InChI | InChI=1S/C41H44N4O2/c1-25-8-12-27(13-9-25)31-19-29-18-30-23-40(3,4)37(43-30)22-34-32(28-14-10-26(2)11-15-28)20-35(44-34)39(47-17-16-46-7)36-24-41(5,6)38(45-36)21-33(31)42-29/h8-15,18-22,42,44H,16-17,23-24H2,1-7H3/b29-18-,30-18-,33-21-,34-22-,37-22-,38-21-,39-35+,39-36+ |
| InChIKey | OGILQWHVRIHFLP-GBRVVGQKSA-N |
| XLogP | 9.33 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.83 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|