About 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin
5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin (PubChem CID 135404821) has the molecular formula C33H24N4O
and a molecular weight of 492.58 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin |
| PubChem CID | 135404821 |
| Molecular Formula | C33H24N4O |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccccc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C33H24N4O/c1-38-27-13-7-22(8-14-27)33-30-17-11-25(36-30)19-23-9-15-28(34-23)32(21-5-3-2-4-6-21)29-16-10-24(35-29)20-26-12-18-31(33)37-26/h2-20,34,37H,1H3/b23-19-,24-20-,25-19-,26-20-,32-28-,32-29-,33-30-,33-31- |
| InChIKey | IGVQITJKMBBURZ-MKHRQQLVSA-N |
| XLogP | 8.00 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin?
The IUPAC name of 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin (CID 135404821) is 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin.
What is the SMILES notation for 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin?
The canonical SMILES for 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin is COc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccccc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin?
The InChIKey is IGVQITJKMBBURZ-MKHRQQLVSA-N. The full InChI is InChI=1S/C33H24N4O/c1-38-27-13-7-22(8-14-27)33-30-17-11-25(36-30)19-23-9-15-28(34-23)32(21-5-3-2-4-6-21)29-16-10-24(35-29)20-26-12-18-31(33)37-26/h2-20,34,37H,1H3/b23-19-,24-20-,25-19-,26-20-,32-28-,32-29-,33-30-,33-31-.
What are the key properties of 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin?
5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin has a molecular weight of 492.58 g/mol, XLogP of 8.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-15-phenyl-21,23-dihydroporphyrin is sourced from PubChem (CID 135404821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).