C44H50N4O8 — CID 46888620
2-[3-[12-[3,5-bis(2-hydroxyethoxy)phenyl]-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]-5-(2-hydroxyethoxy)phenoxy]ethanol (PubChem CID 46888620) has the molecular formula C44H50N4O8 and a molecular weight of 762.90 g/mol. Its IUPAC name is 2-[3-[12-[3,5-bis(2-hydroxyethoxy)phenyl]-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]-5-(2-hydroxyethoxy)phenoxy]ethanol.
| Compound Name | 2-[3-[12-[3,5-bis(2-hydroxyethoxy)phenyl]-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]-5-(2-hydroxyethoxy)phenoxy]ethanol |
|---|---|
| PubChem CID | 46888620 |
| Molecular Formula | C44H50N4O8 |
| Molecular Weight | 762.90 g/mol |
| Exact Mass | 762.36 |
| IUPAC Name | 2-[3-[12-[3,5-bis(2-hydroxyethoxy)phenyl]-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]-5-(2-hydroxyethoxy)phenoxy]ethanol |
| SMILES | CC1(C)Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5-c1cc(OCCO)cc(OCCO)c1)CC4(C)C)cc3-c1cc(OCCO)cc(OCCO)c1 |
| InChI | InChI=1S/C44H50N4O8/c1-43(2)25-31-19-39-38(28-15-35(55-11-7-51)24-36(16-28)56-12-8-52)18-30(46-39)22-42-44(3,4)26-32(48-42)20-40-37(17-29(45-40)21-41(43)47-31)27-13-33(53-9-5-49)23-34(14-27)54-10-6-50/h13-24,45-46,49-52H,5-12,25-26H2,1-4H3/b29-21-,30-22-,31-19-,32-20-,39-19-,40-20-,41-21-,42-22- |
| InChIKey | IXNZVPVLEOVIKK-IUGHWGRXSA-N |
| XLogP | 6.17 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.90 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |