C36H34N4O4 — CID 46888621
5-[12-(3,5-dihydroxyphenyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]benzene-1,3-diol (PubChem CID 46888621) has the molecular formula C36H34N4O4 and a molecular weight of 586.69 g/mol. Its IUPAC name is 5-[12-(3,5-dihydroxyphenyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]benzene-1,3-diol.
| Compound Name | 5-[12-(3,5-dihydroxyphenyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 46888621 |
| Molecular Formula | C36H34N4O4 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 5-[12-(3,5-dihydroxyphenyl)-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]benzene-1,3-diol |
| SMILES | CC1(C)Cc2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)cc5-c1cc(O)cc(O)c1)CC4(C)C)cc3-c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C36H34N4O4/c1-35(2)17-23-11-31-30(20-7-27(43)16-28(44)8-20)10-22(38-31)14-34-36(3,4)18-24(40-34)12-32-29(9-21(37-32)13-33(35)39-23)19-5-25(41)15-26(42)6-19/h5-16,37-38,41-44H,17-18H2,1-4H3/b21-13-,22-14-,23-11-,24-12-,31-11-,32-12-,33-13-,34-14- |
| InChIKey | QQSQMSDZLRJULX-LFCVWLLZSA-N |
| XLogP | 7.51 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |