C42H44N4O3 — CID 153308997
ethyl 12-ethyl-10-methoxy-7,7,17,17-tetramethyl-3,13-diphenyl-8,18,21,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 153308997) has the molecular formula C42H44N4O3 and a molecular weight of 652.84 g/mol. Its IUPAC name is ethyl 12-ethyl-10-methoxy-7,7,17,17-tetramethyl-3,13-diphenyl-8,18,21,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | ethyl 12-ethyl-10-methoxy-7,7,17,17-tetramethyl-3,13-diphenyl-8,18,21,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 153308997 |
| Molecular Formula | C42H44N4O3 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | ethyl 12-ethyl-10-methoxy-7,7,17,17-tetramethyl-3,13-diphenyl-8,18,21,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c2cc3nc(c(OC)c4[nH]c(cc5nc(cc1[nH]2)CC5(C)C)c(-c1ccccc1)c4CC)CC3(C)C |
| InChI | InChI=1S/C42H44N4O3/c1-8-28-35(25-16-12-10-13-17-25)30-21-33-41(3,4)23-27(43-33)20-29-37(40(47)49-9-2)36(26-18-14-11-15-19-26)31(44-29)22-34-42(5,6)24-32(45-34)39(48-7)38(28)46-30/h10-22,44,46H,8-9,23-24H2,1-7H3/b27-20-,29-20-,30-21-,31-22-,33-21-,34-22-,39-32+,39-38+ |
| InChIKey | DWQNXXIGYNNEBE-OSGYVPCNSA-N |
| XLogP | 9.44 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |