C59H50N8O3 — CID 169180168
methyl 4-[12-[4-(21,23-dihydroporphyrin-5-yl)phenyl]-20-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]benzoate (PubChem CID 169180168) has the molecular formula C59H50N8O3 and a molecular weight of 919.10 g/mol. Its IUPAC name is methyl 4-[12-[4-(21,23-dihydroporphyrin-5-yl)phenyl]-20-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]benzoate.
| Compound Name | methyl 4-[12-[4-(21,23-dihydroporphyrin-5-yl)phenyl]-20-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]benzoate |
|---|---|
| PubChem CID | 169180168 |
| Molecular Formula | C59H50N8O3 |
| Molecular Weight | 919.10 g/mol |
| Exact Mass | 918.40 |
| IUPAC Name | methyl 4-[12-[4-(21,23-dihydroporphyrin-5-yl)phenyl]-20-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc3cc4nc(cc5[nH]c(cc6nc(c(OC)c2[nH]3)CC6(C)C)cc5-c2ccc(-c3c5nc(cc6ccc(cc7nc(cc8ccc3[nH]8)C=C7)[nH]6)C=C5)cc2)CC4(C)C)cc1 |
| InChI | InChI=1S/C59H50N8O3/c1-58(2)31-45-28-50-46(33-7-11-35(12-8-33)54-48-21-19-41(62-48)24-39-17-15-37(60-39)23-38-16-18-40(61-38)25-42-20-22-49(54)63-42)26-43(64-50)29-53-59(3,4)32-51(67-53)56(69-5)55-47(27-44(66-55)30-52(58)65-45)34-9-13-36(14-10-34)57(68)70-6/h7-30,60,63-64,66H,31-32H2,1-6H3/b37-23-,38-23-,39-24-,40-25-,41-24-,42-25-,43-29-,44-30-,45-28-,50-28-,52-30-,53-29-,54-48-,54-49-,56-51+,56-55+ |
| InChIKey | LTFIGWXTUDPVKF-RDTLEQHPSA-N |
| XLogP | 13.12 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.10 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |