C48H45N5O2 — CID 177045487
4-(13,13-dimethyl-8,18-diphenyl-22,24-dihydro-12H-porphyrin-5-yl)-N-(4,4-dimethyl-3-oxopentyl)benzamide (PubChem CID 177045487) has the molecular formula C48H45N5O2 and a molecular weight of 723.92 g/mol. Its IUPAC name is 4-(13,13-dimethyl-8,18-diphenyl-22,24-dihydro-12H-porphyrin-5-yl)-N-(4,4-dimethyl-3-oxopentyl)benzamide.
| Compound Name | 4-(13,13-dimethyl-8,18-diphenyl-22,24-dihydro-12H-porphyrin-5-yl)-N-(4,4-dimethyl-3-oxopentyl)benzamide |
|---|---|
| PubChem CID | 177045487 |
| Molecular Formula | C48H45N5O2 |
| Molecular Weight | 723.92 g/mol |
| Exact Mass | 723.36 |
| IUPAC Name | 4-(13,13-dimethyl-8,18-diphenyl-22,24-dihydro-12H-porphyrin-5-yl)-N-(4,4-dimethyl-3-oxopentyl)benzamide |
| SMILES | CC(C)(C)C(=O)CCNC(=O)c1ccc(-c2c3nc(cc4[nH]c(cc5nc(cc6[nH]c2cc6-c2ccccc2)CC5(C)C)cc4-c2ccccc2)C=C3)cc1 |
| InChI | InChI=1S/C48H45N5O2/c1-47(2,3)44(54)22-23-49-46(55)33-18-16-32(17-19-33)45-39-21-20-34(50-39)25-40-37(30-12-8-6-9-13-30)24-35(51-40)27-43-48(4,5)29-36(52-43)26-41-38(28-42(45)53-41)31-14-10-7-11-15-31/h6-21,24-28,51,53H,22-23,29H2,1-5H3,(H,49,55)/b34-25-,35-27-,36-26-,40-25-,41-26-,43-27-,45-39-,45-42- |
| InChIKey | MGGHUMSDVWUPCD-AFZDFSPNSA-N |
| XLogP | 10.74 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.92 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |