C38H37BrN4 — CID 16741319
8-bromo-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin (PubChem CID 16741319) has the molecular formula C38H37BrN4 and a molecular weight of 629.65 g/mol. Its IUPAC name is 8-bromo-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 8-bromo-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 16741319 |
| Molecular Formula | C38H37BrN4 |
| Molecular Weight | 629.65 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | 8-bromo-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin |
| SMILES | Cc1ccc(-c2cc3cc4nc(cc5[nH]c(cc6nc(cc2[nH]3)C(C)(C)C6)c(Br)c5-c2ccc(C)cc2)C(C)(C)C4)cc1 |
| InChI | InChI=1S/C38H37BrN4/c1-22-7-11-24(12-8-22)29-16-26-15-27-20-37(3,4)34(41-27)19-31-35(25-13-9-23(2)10-14-25)36(39)32(43-31)17-28-21-38(5,6)33(42-28)18-30(29)40-26/h7-19,40,43H,20-21H2,1-6H3/b26-15-,27-15-,28-17-,30-18-,31-19-,32-17-,33-18-,34-19- |
| InChIKey | SAXMTTABRITKCI-SVVMRPQNSA-N |
| XLogP | 10.07 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.65 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |