C61H42N4 — CID 122205957
3,3-dimethyl-15-(4-methylphenyl)-8,18-bis(2-phenanthren-9-ylethynyl)-22,23-dihydro-2H-porphyrin (PubChem CID 122205957) has the molecular formula C61H42N4 and a molecular weight of 831.04 g/mol. Its IUPAC name is 3,3-dimethyl-15-(4-methylphenyl)-8,18-bis(2-phenanthren-9-ylethynyl)-22,23-dihydro-2H-porphyrin.
| Compound Name | 3,3-dimethyl-15-(4-methylphenyl)-8,18-bis(2-phenanthren-9-ylethynyl)-22,23-dihydro-2H-porphyrin |
|---|---|
| PubChem CID | 122205957 |
| Molecular Formula | C61H42N4 |
| Molecular Weight | 831.04 g/mol |
| Exact Mass | 830.34 |
| IUPAC Name | 3,3-dimethyl-15-(4-methylphenyl)-8,18-bis(2-phenanthren-9-ylethynyl)-22,23-dihydro-2H-porphyrin |
| SMILES | Cc1ccc(-c2c3nc(cc4nc(cc5cc(C#Cc6cc7ccccc7c7ccccc67)c(cc6ccc2[nH]6)[nH]5)C(C)(C)C4)C(C#Cc2cc4ccccc4c4ccccc24)=C3)cc1 |
| InChI | InChI=1S/C61H42N4/c1-38-20-22-39(23-21-38)60-55-29-28-46(62-55)34-56-44(26-24-42-30-40-12-4-6-14-49(40)53-18-10-8-16-51(42)53)32-47(63-56)36-59-61(2,3)37-48(64-59)35-57-45(33-58(60)65-57)27-25-43-31-41-13-5-7-15-50(41)54-19-11-9-17-52(43)54/h4-23,28-36,62-63H,37H2,1-3H3/b46-34-,47-36-,48-35-,56-34-,57-35-,59-36-,60-55-,60-58- |
| InChIKey | LIQWPPKGVJCCBM-WFXNVWJPSA-N |
| XLogP | 14.42 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.04 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|