C44H39N5 — CID 129287034
4-[2-(2,2,12,12-tetramethyl-10,20-diphenyl-3,13,22,24-tetrahydroporphyrin-5-yl)ethynyl]aniline (PubChem CID 129287034) has the molecular formula C44H39N5 and a molecular weight of 637.83 g/mol. Its IUPAC name is 4-[2-(2,2,12,12-tetramethyl-10,20-diphenyl-3,13,22,24-tetrahydroporphyrin-5-yl)ethynyl]aniline.
| Compound Name | 4-[2-(2,2,12,12-tetramethyl-10,20-diphenyl-3,13,22,24-tetrahydroporphyrin-5-yl)ethynyl]aniline |
|---|---|
| PubChem CID | 129287034 |
| Molecular Formula | C44H39N5 |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | 4-[2-(2,2,12,12-tetramethyl-10,20-diphenyl-3,13,22,24-tetrahydroporphyrin-5-yl)ethynyl]aniline |
| SMILES | CC1(C)Cc2nc1c(-c1ccccc1)c1ccc(cc3nc(c(-c4ccccc4)c4ccc([nH]4)c2C#Cc2ccc(N)cc2)C(C)(C)C3)[nH]1 |
| InChI | InChI=1S/C44H39N5/c1-43(2)26-33-25-32-20-22-36(46-32)39(29-11-7-5-8-12-29)42-44(3,4)27-38(49-42)34(21-17-28-15-18-31(45)19-16-28)35-23-24-37(48-35)40(41(43)47-33)30-13-9-6-10-14-30/h5-16,18-20,22-25,46,48H,26-27,45H2,1-4H3/b32-25-,33-25-,35-34-,38-34-,39-36-,40-37-,41-40-,42-39- |
| InChIKey | PNEZTEDPPJYFSX-OTCZLOFRSA-N |
| XLogP | 9.67 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|