C58H42N8O2 — CID 177273249
methyl 4-[8-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]-13,13-dimethyl-21,24-dihydro-12H-porphyrin-5-yl]benzoate (PubChem CID 177273249) has the molecular formula C58H42N8O2 and a molecular weight of 883.03 g/mol. Its IUPAC name is methyl 4-[8-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]-13,13-dimethyl-21,24-dihydro-12H-porphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[8-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]-13,13-dimethyl-21,24-dihydro-12H-porphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 177273249 |
| Molecular Formula | C58H42N8O2 |
| Molecular Weight | 883.03 g/mol |
| Exact Mass | 882.34 |
| IUPAC Name | methyl 4-[8-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]-13,13-dimethyl-21,24-dihydro-12H-porphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(cc4nc(cc5ccc(cc6ccc2[nH]6)[nH]5)C(C)(C)C4)C(C#Cc2ccc(-c4c5nc(cc6ccc(cc7ccc(cc8nc4C=C8)[nH]7)[nH]6)C=C5)cc2)=C3)cc1 |
| InChI | InChI=1S/C58H42N8O2/c1-58(2)33-48-31-52-38(26-53(66-52)56(36-10-12-37(13-11-36)57(67)68-3)51-25-22-46(64-51)30-43-18-19-47(61-43)32-54(58)65-48)9-6-34-4-7-35(8-5-34)55-49-23-20-44(62-49)28-41-16-14-39(59-41)27-40-15-17-42(60-40)29-45-21-24-50(55)63-45/h4-5,7-8,10-32,59-61,64H,33H2,1-3H3/b39-27-,40-27-,41-28-,42-29-,43-30-,44-28-,45-29-,46-30-,47-32-,48-31-,52-31-,54-32-,55-49-,55-50-,56-51-,56-53- |
| InChIKey | NUYOIYHOTAWPBU-ZGIRGWFJSA-N |
| XLogP | 12.52 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.03 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|