C59H44N8O2 — CID 165406352
methyl 4-[13,13-dimethyl-8-[2-[4-(24-methyl-23H-porphyrin-5-yl)phenyl]ethynyl]-21,24-dihydro-12H-porphyrin-5-yl]benzoate (PubChem CID 165406352) has the molecular formula C59H44N8O2 and a molecular weight of 897.05 g/mol. Its IUPAC name is methyl 4-[13,13-dimethyl-8-[2-[4-(24-methyl-23H-porphyrin-5-yl)phenyl]ethynyl]-21,24-dihydro-12H-porphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[13,13-dimethyl-8-[2-[4-(24-methyl-23H-porphyrin-5-yl)phenyl]ethynyl]-21,24-dihydro-12H-porphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 165406352 |
| Molecular Formula | C59H44N8O2 |
| Molecular Weight | 897.05 g/mol |
| Exact Mass | 896.36 |
| IUPAC Name | methyl 4-[13,13-dimethyl-8-[2-[4-(24-methyl-23H-porphyrin-5-yl)phenyl]ethynyl]-21,24-dihydro-12H-porphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(cc4nc(cc5ccc(cc6ccc2[nH]6)[nH]5)C(C)(C)C4)C(C#Cc2ccc(-c4c5nc(cc6ccc(cc7ccc(cc8nc4C=C8)n7C)[nH]6)C=C5)cc2)=C3)cc1 |
| InChI | InChI=1S/C59H44N8O2/c1-59(2)34-47-32-53-39(27-54(66-53)57(37-11-13-38(14-12-37)58(68)69-4)52-25-20-43(63-52)29-41-16-18-46(61-41)33-55(59)65-47)10-7-35-5-8-36(9-6-35)56-50-24-19-42(62-50)28-40-15-17-44(60-40)30-48-22-23-49(67(48)3)31-45-21-26-51(56)64-45/h5-6,8-9,11-33,60-61,63H,34H2,1-4H3/b40-28-,41-29-,42-28-,43-29-,44-30-,45-31-,46-33-,47-32-,48-30-,49-31-,53-32-,55-33-,56-50-,56-51-,57-52-,57-54- |
| InChIKey | OEOUZYYWUWUMKA-GGNVETBVSA-N |
| XLogP | 12.53 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.05 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|