C54H34N8 — CID 86093566
15-[4-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]phenyl]-21,22-dihydroporphyrin (PubChem CID 86093566) has the molecular formula C54H34N8 and a molecular weight of 794.92 g/mol. Its IUPAC name is 15-[4-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]phenyl]-21,22-dihydroporphyrin.
| Compound Name | 15-[4-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]phenyl]-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 86093566 |
| Molecular Formula | C54H34N8 |
| Molecular Weight | 794.92 g/mol |
| Exact Mass | 794.29 |
| IUPAC Name | 15-[4-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]phenyl]-21,22-dihydroporphyrin |
| SMILES | C(#Cc1ccc(-c2c3nc(cc4ccc(cc5ccc(cc6nc2C=C6)[nH]5)[nH]4)C=C3)cc1)c1ccc(-c2c3nc(cc4ccc(cc5ccc(cc6nc2C=C6)[nH]5)[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C54H34N8/c1(33-3-7-35(8-4-33)53-49-23-19-45(59-49)29-41-15-11-37(55-41)27-38-12-16-42(56-38)30-46-20-24-50(53)60-46)2-34-5-9-36(10-6-34)54-51-25-21-47(61-51)31-43-17-13-39(57-43)28-40-14-18-44(58-40)32-48-22-26-52(54)62-48/h3-32,55-58H/b37-27-,38-27-,39-28-,40-28-,41-29-,42-30-,43-31-,44-32-,45-29-,46-30-,47-31-,48-32-,53-49-,53-50-,54-51-,54-52- |
| InChIKey | KTEQEWSKCSYSBC-BKBMIAHLSA-N |
| XLogP | 12.36 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.92 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|