C66H40N8 — CID 101212276
15-[4-[2-[4-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]naphthalen-1-yl]ethynyl]phenyl]-21,22-dihydroporphyrin (PubChem CID 101212276) has the molecular formula C66H40N8 and a molecular weight of 945.10 g/mol. Its IUPAC name is 15-[4-[2-[4-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]naphthalen-1-yl]ethynyl]phenyl]-21,22-dihydroporphyrin.
| Compound Name | 15-[4-[2-[4-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]naphthalen-1-yl]ethynyl]phenyl]-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 101212276 |
| Molecular Formula | C66H40N8 |
| Molecular Weight | 945.10 g/mol |
| Exact Mass | 944.34 |
| IUPAC Name | 15-[4-[2-[4-[2-[4-(23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]naphthalen-1-yl]ethynyl]phenyl]-21,22-dihydroporphyrin |
| SMILES | C(#Cc1ccc(C#Cc2ccc(-c3c4nc(cc5ccc(cc6ccc(cc7nc3C=C7)[nH]6)[nH]5)C=C4)cc2)c2ccccc12)c1ccc(-c2c3nc(cc4ccc(cc5ccc(cc6nc2C=C6)[nH]5)[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C66H40N8/c1-2-4-60-44(12-6-42-9-15-46(16-10-42)66-63-33-29-57(73-63)39-53-25-21-49(69-53)36-50-22-26-54(70-50)40-58-30-34-64(66)74-58)18-17-43(59(60)3-1)11-5-41-7-13-45(14-8-41)65-61-31-27-55(71-61)37-51-23-19-47(67-51)35-48-20-24-52(68-48)38-56-28-32-62(65)72-56/h1-4,7-10,13-40,67-70H/b47-35-,48-35-,49-36-,50-36-,51-37-,52-38-,53-39-,54-40-,55-37-,56-38-,57-39-,58-40-,65-61-,65-62-,66-63-,66-64- |
| InChIKey | JQTHLTXFWLSBAM-GJFKBWHZSA-N |
| XLogP | 14.91 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.10 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|