C40H26N4 — CID 175496055
2-(4-ethynylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin (PubChem CID 175496055) has the molecular formula C40H26N4 and a molecular weight of 562.68 g/mol. Its IUPAC name is 2-(4-ethynylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin.
| Compound Name | 2-(4-ethynylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 175496055 |
| Molecular Formula | C40H26N4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 2-(4-ethynylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin |
| SMILES | C#Cc1ccc(-c2cc3cc4nc(c(-c5ccccc5)c5ccc(cc6nc(c(-c7ccccc7)c2[nH]3)C=C6)[nH]5)C=C4)cc1 |
| InChI | InChI=1S/C40H26N4/c1-2-26-13-15-27(16-14-26)34-25-33-24-32-18-21-36(42-32)38(28-9-5-3-6-10-28)35-20-17-30(41-35)23-31-19-22-37(43-31)39(40(34)44-33)29-11-7-4-8-12-29/h1,3-25,41,44H/b30-23-,31-23-,32-24-,33-24-,38-35-,38-36-,39-37-,40-39- |
| InChIKey | BSMBLFIAXOMPNI-ATUUSDCASA-N |
| XLogP | 9.64 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|