C44H30AuN4 — CID 174635245
gold;2,10,15,20-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 174635245) has the molecular formula C44H30AuN4 and a molecular weight of 811.72 g/mol. Its IUPAC name is gold;2,10,15,20-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | gold;2,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 174635245 |
| Molecular Formula | C44H30AuN4 |
| Molecular Weight | 811.72 g/mol |
| Exact Mass | 811.21 |
| IUPAC Name | gold;2,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1cc1cc(-c3ccccc3)c([nH]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c2-c2ccccc2)C=C1.[Au] |
| InChI | InChI=1S/C44H30N4.Au/c1-5-13-29(14-6-1)35-28-34-27-33-21-22-36(45-33)41(30-15-7-2-8-16-30)37-23-24-38(47-37)42(31-17-9-3-10-18-31)39-25-26-40(48-39)43(44(35)46-34)32-19-11-4-12-20-32;/h1-28,46-47H;/b33-27-,34-27-,41-36-,41-37-,42-38-,42-39-,43-40-,44-43-; |
| InChIKey | YQCUDZNQKFCTSQ-LLHMYSFUSA-N |
| XLogP | 11.32 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.72 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |