C38H26N4O — CID 151835088
4-(10,20-diphenyl-21,23-dihydroporphyrin-2-yl)phenol (PubChem CID 151835088) has the molecular formula C38H26N4O and a molecular weight of 554.65 g/mol. Its IUPAC name is 4-(10,20-diphenyl-21,23-dihydroporphyrin-2-yl)phenol.
| Compound Name | 4-(10,20-diphenyl-21,23-dihydroporphyrin-2-yl)phenol |
|---|---|
| PubChem CID | 151835088 |
| Molecular Formula | C38H26N4O |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 4-(10,20-diphenyl-21,23-dihydroporphyrin-2-yl)phenol |
| SMILES | Oc1ccc(-c2cc3cc4nc(c(-c5ccccc5)c5ccc(cc6nc(c(-c7ccccc7)c2[nH]3)C=C6)[nH]5)C=C4)cc1 |
| InChI | InChI=1S/C38H26N4O/c43-31-16-11-24(12-17-31)32-23-30-22-29-14-19-34(40-29)36(25-7-3-1-4-8-25)33-18-13-27(39-33)21-28-15-20-35(41-28)37(38(32)42-30)26-9-5-2-6-10-26/h1-23,39,42-43H/b27-21-,28-21-,29-22-,30-22-,36-33-,36-34-,37-35-,38-37- |
| InChIKey | SFMIOBCNTLELAJ-WGBZDOOVSA-N |
| XLogP | 9.36 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |