C26H13F5N4 — CID 87223588
15-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin (PubChem CID 87223588) has the molecular formula C26H13F5N4 and a molecular weight of 476.41 g/mol. Its IUPAC name is 15-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin.
| Compound Name | 15-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 87223588 |
| Molecular Formula | C26H13F5N4 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 15-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(cc4ccc(cc5ccc(cc6nc2C=C6)[nH]5)[nH]4)C=C3)c(F)c1F |
| InChI | InChI=1S/C26H13F5N4/c27-22-21(23(28)25(30)26(31)24(22)29)20-18-7-5-16(34-18)10-14-3-1-12(32-14)9-13-2-4-15(33-13)11-17-6-8-19(20)35-17/h1-11,32-33H/b12-9-,13-9-,14-10-,15-11-,16-10-,17-11-,20-18+,20-19+ |
| InChIKey | GJTJFVMXXGHORO-DRCNEUIKSA-N |
| XLogP | 7.02 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|