C26H13F5N4 — CID 23510854
2-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin (PubChem CID 23510854) has the molecular formula C26H13F5N4 and a molecular weight of 476.41 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 23510854 |
| Molecular Formula | C26H13F5N4 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2cc3cc4ccc(cc5nc(cc6nc(cc2[nH]3)C=C6)C=C5)[nH]4)c(F)c1F |
| InChI | InChI=1S/C26H13F5N4/c27-22-21(23(28)25(30)26(31)24(22)29)19-10-18-9-16-4-3-14(33-16)7-12-1-2-13(32-12)8-15-5-6-17(34-15)11-20(19)35-18/h1-11,33,35H/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11- |
| InChIKey | MQSUEOZNTKEDRC-ZFGIDIDVSA-N |
| XLogP | 7.02 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|