C30H20N4O — CID 161017382
1-(21,22-dihydroporphyrin-2-yl)naphthalen-2-ol (PubChem CID 161017382) has the molecular formula C30H20N4O and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-(21,22-dihydroporphyrin-2-yl)naphthalen-2-ol.
| Compound Name | 1-(21,22-dihydroporphyrin-2-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 161017382 |
| Molecular Formula | C30H20N4O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-(21,22-dihydroporphyrin-2-yl)naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1-c1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3 |
| InChI | InChI=1S/C30H20N4O/c35-29-12-5-18-3-1-2-4-26(18)30(29)27-16-25-15-23-9-8-21(32-23)13-19-6-7-20(31-19)14-22-10-11-24(33-22)17-28(27)34-25/h1-17,32,34-35H/b19-13-,20-14-,21-13-,22-14-,23-15-,24-17-,25-15-,28-17- |
| InChIKey | AXEWKYVKQFUAOM-YGKYYQRHSA-N |
| XLogP | 7.18 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |