C26H19MnN5 — CID 175045676
3-(21,22-dihydroporphyrin-2-yl)aniline;manganese (PubChem CID 175045676) has the molecular formula C26H19MnN5 and a molecular weight of 456.41 g/mol. Its IUPAC name is 3-(21,22-dihydroporphyrin-2-yl)aniline;manganese.
| Compound Name | 3-(21,22-dihydroporphyrin-2-yl)aniline;manganese |
|---|---|
| PubChem CID | 175045676 |
| Molecular Formula | C26H19MnN5 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 3-(21,22-dihydroporphyrin-2-yl)aniline;manganese |
| SMILES | Nc1cccc(-c2cc3cc4ccc(cc5nc(cc6nc(cc2[nH]3)C=C6)C=C5)[nH]4)c1.[Mn] |
| InChI | InChI=1S/C26H19N5.Mn/c27-17-3-1-2-16(10-17)25-14-24-13-22-7-6-20(29-22)11-18-4-5-19(28-18)12-21-8-9-23(30-21)15-26(25)31-24;/h1-15,29,31H,27H2;/b18-11-,19-12-,20-11-,21-12-,22-13-,23-15-,24-13-,26-15-; |
| InChIKey | VMWHTWUWMUAEMX-LSEBBXRNSA-N |
| XLogP | 5.90 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|