C28H22N4O2 — CID 22228529
2-(3,5-dimethoxyphenyl)-21,22-dihydroporphyrin (PubChem CID 22228529) has the molecular formula C28H22N4O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-21,22-dihydroporphyrin.
| Compound Name | 2-(3,5-dimethoxyphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 22228529 |
| Molecular Formula | C28H22N4O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-21,22-dihydroporphyrin |
| SMILES | COc1cc(OC)cc(-c2cc3cc4ccc(cc5nc(cc6nc(cc2[nH]3)C=C6)C=C5)[nH]4)c1 |
| InChI | InChI=1S/C28H22N4O2/c1-33-25-9-17(10-26(16-25)34-2)27-14-24-13-22-6-5-20(30-22)11-18-3-4-19(29-18)12-21-7-8-23(31-21)15-28(27)32-24/h3-16,30,32H,1-2H3/b18-11-,19-12-,20-11-,21-12-,22-13-,23-15-,24-13-,28-15- |
| InChIKey | YHKOZUYYQBIDSQ-TZCBIZDUSA-N |
| XLogP | 6.34 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |