C29H24N4O5 — CID 141443463
2-[5-(21,22-dihydroporphyrin-2-yl)-2-methoxyphenyl]ethane-1,1,1,2-tetrol (PubChem CID 141443463) has the molecular formula C29H24N4O5 and a molecular weight of 508.53 g/mol. Its IUPAC name is 2-[5-(21,22-dihydroporphyrin-2-yl)-2-methoxyphenyl]ethane-1,1,1,2-tetrol.
| Compound Name | 2-[5-(21,22-dihydroporphyrin-2-yl)-2-methoxyphenyl]ethane-1,1,1,2-tetrol |
|---|---|
| PubChem CID | 141443463 |
| Molecular Formula | C29H24N4O5 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 2-[5-(21,22-dihydroporphyrin-2-yl)-2-methoxyphenyl]ethane-1,1,1,2-tetrol |
| SMILES | COc1ccc(-c2cc3cc4ccc(cc5nc(cc6nc(cc2[nH]3)C=C6)C=C5)[nH]4)cc1C(O)C(O)(O)O |
| InChI | InChI=1S/C29H24N4O5/c1-38-27-9-2-16(10-25(27)28(34)29(35,36)37)24-14-23-13-21-6-5-19(31-21)11-17-3-4-18(30-17)12-20-7-8-22(32-20)15-26(24)33-23/h2-15,28,31,33-37H,1H3/b17-11-,18-12-,19-11-,20-12-,21-13-,22-15-,23-13-,26-15- |
| InChIKey | ANYORELYFQNYMM-MSAGHTCWSA-N |
| XLogP | 4.00 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|