C44H54N4O3 — CID 160670225
2-(3,4,5-trihexoxyphenyl)-21,22-dihydroporphyrin (PubChem CID 160670225) has the molecular formula C44H54N4O3 and a molecular weight of 686.94 g/mol. Its IUPAC name is 2-(3,4,5-trihexoxyphenyl)-21,22-dihydroporphyrin.
| Compound Name | 2-(3,4,5-trihexoxyphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 160670225 |
| Molecular Formula | C44H54N4O3 |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.42 |
| IUPAC Name | 2-(3,4,5-trihexoxyphenyl)-21,22-dihydroporphyrin |
| SMILES | CCCCCCOc1cc(-c2cc3cc4ccc(cc5nc(cc6nc(cc2[nH]3)C=C6)C=C5)[nH]4)cc(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C44H54N4O3/c1-4-7-10-13-22-49-42-25-32(26-43(50-23-14-11-8-5-2)44(42)51-24-15-12-9-6-3)40-30-39-29-37-19-18-35(46-37)27-33-16-17-34(45-33)28-36-20-21-38(47-36)31-41(40)48-39/h16-21,25-31,46,48H,4-15,22-24H2,1-3H3/b33-27-,34-28-,35-27-,36-28-,37-29-,38-31-,39-29-,41-31- |
| InChIKey | DBNZYVLREYDTRM-RPVPEAEBSA-N |
| XLogP | 12.20 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|