C23H22MnN6O — CID 70007188
3-(21,22-dihydroporphyrin-2-yloxy)propane-1,1-diamine;manganese (PubChem CID 70007188) has the molecular formula C23H22MnN6O and a molecular weight of 453.41 g/mol. Its IUPAC name is 3-(21,22-dihydroporphyrin-2-yloxy)propane-1,1-diamine;manganese.
| Compound Name | 3-(21,22-dihydroporphyrin-2-yloxy)propane-1,1-diamine;manganese |
|---|---|
| PubChem CID | 70007188 |
| Molecular Formula | C23H22MnN6O |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 3-(21,22-dihydroporphyrin-2-yloxy)propane-1,1-diamine;manganese |
| SMILES | NC(N)CCOc1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3.[Mn] |
| InChI | InChI=1S/C23H22N6O.Mn/c24-23(25)7-8-30-22-13-20-11-18-4-3-16(27-18)9-14-1-2-15(26-14)10-17-5-6-19(28-17)12-21(22)29-20;/h1-6,9-13,23,27,29H,7-8,24-25H2;/b14-9-,15-10-,16-9-,17-10-,18-11-,19-12-,20-11-,21-12-; |
| InChIKey | RJLLFRQFHMMGKU-NYKIHJFWSA-N |
| XLogP | 3.67 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|