C21H16N4O — CID 66699316
2-methoxy-21,22-dihydroporphyrin (PubChem CID 66699316) has the molecular formula C21H16N4O and a molecular weight of 340.39 g/mol. Its IUPAC name is 2-methoxy-21,22-dihydroporphyrin.
| Compound Name | 2-methoxy-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 66699316 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-methoxy-21,22-dihydroporphyrin |
| SMILES | COc1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3 |
| InChI | InChI=1S/C21H16N4O/c1-26-21-12-19-10-17-5-4-15(23-17)8-13-2-3-14(22-13)9-16-6-7-18(24-16)11-20(21)25-19/h2-12,23,25H,1H3/b13-8-,14-9-,15-8-,16-9-,17-10-,18-11-,19-10-,20-11- |
| InChIKey | QBDMKUCHYXMDMF-HORAPOCDSA-N |
| XLogP | 4.66 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |