C30H28N4S — CID 160943824
2-(5-hexylthiophen-2-yl)-21,22-dihydroporphyrin (PubChem CID 160943824) has the molecular formula C30H28N4S and a molecular weight of 476.65 g/mol. Its IUPAC name is 2-(5-hexylthiophen-2-yl)-21,22-dihydroporphyrin.
| Compound Name | 2-(5-hexylthiophen-2-yl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 160943824 |
| Molecular Formula | C30H28N4S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-(5-hexylthiophen-2-yl)-21,22-dihydroporphyrin |
| SMILES | CCCCCCc1ccc(-c2cc3cc4ccc(cc5nc(cc6nc(cc2[nH]3)C=C6)C=C5)[nH]4)s1 |
| InChI | InChI=1S/C30H28N4S/c1-2-3-4-5-6-27-13-14-30(35-27)28-18-26-17-24-10-9-22(32-24)15-20-7-8-21(31-20)16-23-11-12-25(33-23)19-29(28)34-26/h7-19,32,34H,2-6H2,1H3/b20-15-,21-16-,22-15-,23-16-,24-17-,25-19-,26-17-,29-19- |
| InChIKey | SEOITIGGXCUZBN-WCOVXWFASA-N |
| XLogP | 8.51 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|