C49H54N4 — CID 150029699
2-(9,9-dioctylfluoren-1-yl)-21,22-dihydroporphyrin (PubChem CID 150029699) has the molecular formula C49H54N4 and a molecular weight of 699.00 g/mol. Its IUPAC name is 2-(9,9-dioctylfluoren-1-yl)-21,22-dihydroporphyrin.
| Compound Name | 2-(9,9-dioctylfluoren-1-yl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 150029699 |
| Molecular Formula | C49H54N4 |
| Molecular Weight | 699.00 g/mol |
| Exact Mass | 698.43 |
| IUPAC Name | 2-(9,9-dioctylfluoren-1-yl)-21,22-dihydroporphyrin |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2cccc(-c3cc4cc5ccc(cc6nc(cc7nc(cc3[nH]4)C=C7)C=C6)[nH]5)c21 |
| InChI | InChI=1S/C49H54N4/c1-3-5-7-9-11-15-28-49(29-16-12-10-8-6-4-2)46-21-14-13-18-42(46)43-19-17-20-44(48(43)49)45-33-41-32-39-25-24-37(51-39)30-35-22-23-36(50-35)31-38-26-27-40(52-38)34-47(45)53-41/h13-14,17-27,30-34,51,53H,3-12,15-16,28-29H2,1-2H3/b35-30-,36-31-,37-30-,38-31-,39-32-,40-34-,41-32-,47-34- |
| InChIKey | ICSGOQZQZDYXOW-WNSBMKKBSA-N |
| XLogP | 14.09 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.00 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|