C28H18N4S — CID 70566297
2-(1-benzothiophen-2-yl)-21,22-dihydroporphyrin (PubChem CID 70566297) has the molecular formula C28H18N4S and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-21,22-dihydroporphyrin.
| Compound Name | 2-(1-benzothiophen-2-yl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 70566297 |
| Molecular Formula | C28H18N4S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-21,22-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc(cc4cc(-c5cc6ccccc6s5)c(cc5nc(cc1n2)C=C5)[nH]4)[nH]3 |
| InChI | InChI=1S/C28H18N4S/c1-2-4-27-17(3-1)11-28(33-27)25-15-24-14-22-8-7-20(30-22)12-18-5-6-19(29-18)13-21-9-10-23(31-21)16-26(25)32-24/h1-16,30,32H/b18-12-,19-13-,20-12-,21-13-,22-14-,23-16-,24-14-,26-16- |
| InChIKey | OOLJLAPSLACUBC-QACVNNBASA-N |
| XLogP | 7.54 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |