C28H23CoN4O- — CID 174404824
cobalt;21,22-dihydroporphyrin;1-methanidyl-4-methoxybenzene (PubChem CID 174404824) has the molecular formula C28H23CoN4O- and a molecular weight of 490.45 g/mol. Its IUPAC name is cobalt;21,22-dihydroporphyrin;1-methanidyl-4-methoxybenzene.
| Compound Name | cobalt;21,22-dihydroporphyrin;1-methanidyl-4-methoxybenzene |
|---|---|
| PubChem CID | 174404824 |
| Molecular Formula | C28H23CoN4O- |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | cobalt;21,22-dihydroporphyrin;1-methanidyl-4-methoxybenzene |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[CH2-]c1ccc(OC)cc1.[Co] |
| InChI | InChI=1S/C20H14N4.C8H9O.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-7-3-5-8(9-2)6-4-7;/h1-12,21-22H;3-6H,1H2,2H3;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | PJNPSABTQWTVTJ-IAULSPAKSA-N |
| XLogP | 6.53 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|