C28H21BrN4O — CID 172831949
2-[4-(2-bromoethoxy)phenyl]-21,22-dihydroporphyrin (PubChem CID 172831949) has the molecular formula C28H21BrN4O and a molecular weight of 509.41 g/mol. Its IUPAC name is 2-[4-(2-bromoethoxy)phenyl]-21,22-dihydroporphyrin.
| Compound Name | 2-[4-(2-bromoethoxy)phenyl]-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 172831949 |
| Molecular Formula | C28H21BrN4O |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 2-[4-(2-bromoethoxy)phenyl]-21,22-dihydroporphyrin |
| SMILES | BrCCOc1ccc(-c2cc3cc4ccc(cc5nc(cc6nc(cc2[nH]3)C=C6)C=C5)[nH]4)cc1 |
| InChI | InChI=1S/C28H21BrN4O/c29-11-12-34-26-9-1-18(2-10-26)27-16-25-15-23-6-5-21(31-23)13-19-3-4-20(30-19)14-22-7-8-24(32-22)17-28(27)33-25/h1-10,13-17,31,33H,11-12H2/b19-13-,20-14-,21-13-,22-14-,23-15-,24-17-,25-15-,28-17- |
| InChIKey | PHBWLTYYUQVZMB-YGKYYQRHSA-N |
| XLogP | 7.10 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|