C26H11F5N4S2 — CID 139756035
26-(2,3,4,5,6-pentafluorophenyl)-3,4-dithia-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13(25),14,16,18,20(23),21-undecaene (PubChem CID 139756035) has the molecular formula C26H11F5N4S2 and a molecular weight of 538.53 g/mol. Its IUPAC name is 26-(2,3,4,5,6-pentafluorophenyl)-3,4-dithia-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13(25),14,16,18,20(23),21-undecaene.
| Compound Name | 26-(2,3,4,5,6-pentafluorophenyl)-3,4-dithia-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13(25),14,16,18,20(23),21-undecaene |
|---|---|
| PubChem CID | 139756035 |
| Molecular Formula | C26H11F5N4S2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | 26-(2,3,4,5,6-pentafluorophenyl)-3,4-dithia-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13(25),14,16,18,20(23),21-undecaene |
| SMILES | Fc1c(F)c(F)c(-c2c3c4[nH]c2cc2nc(cc5ccc(cc6nc(c4SS3)C=C6)[nH]5)C=C2)c(F)c1F |
| InChI | InChI=1S/C26H11F5N4S2/c27-19-18(20(28)22(30)23(31)21(19)29)17-16-9-14-4-3-11(33-14)7-10-1-2-12(32-10)8-13-5-6-15(34-13)25-24(35-16)26(17)37-36-25/h1-9,32,35H/b10-7-,11-7-,12-8-,13-8-,14-9-,16-9-,25-15+ |
| InChIKey | SOHWHUAKDRDQPY-QTVSFXECSA-N |
| XLogP | 8.13 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|