C44H9BrF20N4 — CID 142760254
8-bromo-2,3,5,7-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin (PubChem CID 142760254) has the molecular formula C44H9BrF20N4 and a molecular weight of 1053.45 g/mol. Its IUPAC name is 8-bromo-2,3,5,7-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 8-bromo-2,3,5,7-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 142760254 |
| Molecular Formula | C44H9BrF20N4 |
| Molecular Weight | 1053.45 g/mol |
| Exact Mass | 1051.97 |
| IUPAC Name | 8-bromo-2,3,5,7-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=C(Br)c3cc4ccc(cc5nc(cc6[nH]c(c(-c7c(F)c(F)c(F)c(F)c7F)c2n3)c(-c2c(F)c(F)c(F)c(F)c2F)c6-c2c(F)c(F)c(F)c(F)c2F)C=C5)[nH]4)c(F)c1F |
| InChI | InChI=1S/C44H9BrF20N4/c45-22-13-7-11-4-2-9(67-11)5-8-1-3-10(66-8)6-12-14(17-23(46)31(54)39(62)32(55)24(17)47)15(18-25(48)33(56)40(63)34(57)26(18)49)43(68-12)21(20-29(52)37(60)42(65)38(61)30(20)53)44(69-13)16(22)19-27(50)35(58)41(64)36(59)28(19)51/h1-7,67-68H/b8-5-,9-5-,10-6-,11-7-,12-6-,13-7-,43-21-,44-21- |
| InChIKey | PALJZUYXRYTSJT-MFDMLRHPSA-N |
| XLogP | 14.58 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.45 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|