C25H26Br2N4OS — CID 142365677
(12-bromo-10-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl) thiohypobromite (PubChem CID 142365677) has the molecular formula C25H26Br2N4OS and a molecular weight of 590.39 g/mol. Its IUPAC name is (12-bromo-10-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl) thiohypobromite.
| Compound Name | (12-bromo-10-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl) thiohypobromite |
|---|---|
| PubChem CID | 142365677 |
| Molecular Formula | C25H26Br2N4OS |
| Molecular Weight | 590.39 g/mol |
| Exact Mass | 588.02 |
| IUPAC Name | (12-bromo-10-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl) thiohypobromite |
| SMILES | COc1c2nc(cc3cc(SBr)c(cc4nc(cc5cc(Br)c1[nH]5)C(C)(C)C4)[nH]3)C(C)(C)C2 |
| InChI | InChI=1S/C25H26Br2N4OS/c1-24(2)11-15-7-17-19(33-27)8-14(28-17)10-21-25(3,4)12-18(31-21)23(32-5)22-16(26)6-13(30-22)9-20(24)29-15/h6-10,28,30H,11-12H2,1-5H3/b13-9-,14-10-,15-7-,17-7-,20-9-,21-10-,23-18+,23-22+ |
| InChIKey | JJVQQQYQVJHYRL-GXARPQQCSA-N |
| XLogP | 7.53 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.39 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |