C34H42N4O4 — CID 134265555
diethyl 3,13-diethyl-8,8,18,18-tetramethyl-7,17,21,23-tetrahydroporphyrin-2,12-dicarboxylate (PubChem CID 134265555) has the molecular formula C34H42N4O4 and a molecular weight of 570.73 g/mol. Its IUPAC name is diethyl 3,13-diethyl-8,8,18,18-tetramethyl-7,17,21,23-tetrahydroporphyrin-2,12-dicarboxylate.
| Compound Name | diethyl 3,13-diethyl-8,8,18,18-tetramethyl-7,17,21,23-tetrahydroporphyrin-2,12-dicarboxylate |
|---|---|
| PubChem CID | 134265555 |
| Molecular Formula | C34H42N4O4 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | diethyl 3,13-diethyl-8,8,18,18-tetramethyl-7,17,21,23-tetrahydroporphyrin-2,12-dicarboxylate |
| SMILES | CCOC(=O)c1c(CC)c2cc3nc(cc4[nH]c(cc5nc(cc1[nH]2)C(C)(C)C5)c(CC)c4C(=O)OCC)C(C)(C)C3 |
| InChI | InChI=1S/C34H42N4O4/c1-9-21-23-13-19-17-33(5,6)28(35-19)16-26-30(32(40)42-12-4)22(10-2)24(38-26)14-20-18-34(7,8)27(36-20)15-25(37-23)29(21)31(39)41-11-3/h13-16,37-38H,9-12,17-18H2,1-8H3/b19-13-,20-14-,23-13-,24-14-,25-15-,26-16-,27-15-,28-16- |
| InChIKey | RZYZNQJIWJXYSD-RGQTZQPPSA-N |
| XLogP | 6.83 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |